C6H4N4O3 — CID 53422950
5,8-dihydro-1H-pteridine-2,6,7-trione (PubChem CID 53422950) has the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. Its IUPAC name is 5,8-dihydro-1H-pteridine-2,6,7-trione.
| Compound Name | 5,8-dihydro-1H-pteridine-2,6,7-trione |
|---|---|
| PubChem CID | 53422950 |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 5,8-dihydro-1H-pteridine-2,6,7-trione |
| SMILES | O=c1ncc2[nH]c(=O)c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C6H4N4O3/c11-4-5(12)9-3-2(8-4)1-7-6(13)10-3/h1H,(H,8,11)(H2,7,9,10,12,13) |
| InChIKey | YTQVBDVNLXWPPV-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|