About (3,4-dimethylphenyl)methanamine;hydrochloride
(3,4-dimethylphenyl)methanamine;hydrochloride (PubChem CID 53423775) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl)methanamine;hydrochloride |
| PubChem CID | 53423775 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (3,4-dimethylphenyl)methanamine;hydrochloride |
| SMILES | Cc1ccc(CN)cc1C.Cl |
| InChI | InChI=1S/C9H13N.ClH/c1-7-3-4-9(6-10)5-8(7)2;/h3-5H,6,10H2,1-2H3;1H |
| InChIKey | LNWTYZPFKHGCFM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,4-dimethylphenyl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl)methanamine;hydrochloride?
The IUPAC name of (3,4-dimethylphenyl)methanamine;hydrochloride (CID 53423775) is (3,4-dimethylphenyl)methanamine;hydrochloride.
What is the SMILES notation for (3,4-dimethylphenyl)methanamine;hydrochloride?
The canonical SMILES for (3,4-dimethylphenyl)methanamine;hydrochloride is Cc1ccc(CN)cc1C.Cl.
What is the InChIKey of (3,4-dimethylphenyl)methanamine;hydrochloride?
The InChIKey is LNWTYZPFKHGCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.ClH/c1-7-3-4-9(6-10)5-8(7)2;/h3-5H,6,10H2,1-2H3;1H.
What are the key properties of (3,4-dimethylphenyl)methanamine;hydrochloride?
(3,4-dimethylphenyl)methanamine;hydrochloride has a molecular weight of 171.67 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)methanamine;hydrochloride is sourced from PubChem (CID 53423775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).