About 1-(5,6-dimethylpyrazin-2-yl)ethanone
1-(5,6-dimethylpyrazin-2-yl)ethanone (PubChem CID 53423848) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-(5,6-dimethylpyrazin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5,6-dimethylpyrazin-2-yl)ethanone |
| PubChem CID | 53423848 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-(5,6-dimethylpyrazin-2-yl)ethanone |
| SMILES | CC(=O)c1cnc(C)c(C)n1 |
| InChI | InChI=1S/C8H10N2O/c1-5-6(2)10-8(4-9-5)7(3)11/h4H,1-3H3 |
| InChIKey | PHIMZXOSIVXOQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,6-dimethylpyrazin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethylpyrazin-2-yl)ethanone?
The IUPAC name of 1-(5,6-dimethylpyrazin-2-yl)ethanone (CID 53423848) is 1-(5,6-dimethylpyrazin-2-yl)ethanone.
What is the SMILES notation for 1-(5,6-dimethylpyrazin-2-yl)ethanone?
The canonical SMILES for 1-(5,6-dimethylpyrazin-2-yl)ethanone is CC(=O)c1cnc(C)c(C)n1.
What is the InChIKey of 1-(5,6-dimethylpyrazin-2-yl)ethanone?
The InChIKey is PHIMZXOSIVXOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-5-6(2)10-8(4-9-5)7(3)11/h4H,1-3H3.
What are the key properties of 1-(5,6-dimethylpyrazin-2-yl)ethanone?
1-(5,6-dimethylpyrazin-2-yl)ethanone has a molecular weight of 150.18 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethylpyrazin-2-yl)ethanone is sourced from PubChem (CID 53423848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).