About 5-aminoindol-2-one
5-aminoindol-2-one (PubChem CID 53423911) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-aminoindol-2-one.
Molecular Properties
| Compound Name | 5-aminoindol-2-one |
| PubChem CID | 53423911 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 5-aminoindol-2-one |
| SMILES | Nc1ccc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C8H6N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-4H,9H2 |
| InChIKey | KGUNAWIEJKEGSJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-aminoindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminoindol-2-one?
The IUPAC name of 5-aminoindol-2-one (CID 53423911) is 5-aminoindol-2-one.
What is the SMILES notation for 5-aminoindol-2-one?
The canonical SMILES for 5-aminoindol-2-one is Nc1ccc2c(c1)=CC(=O)N=2.
What is the InChIKey of 5-aminoindol-2-one?
The InChIKey is KGUNAWIEJKEGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-4H,9H2.
What are the key properties of 5-aminoindol-2-one?
5-aminoindol-2-one has a molecular weight of 146.15 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminoindol-2-one is sourced from PubChem (CID 53423911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).