C29H31ClN2O — CID 53424010
1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]-5-phenylmethoxyindole chloride (PubChem CID 53424010) has the molecular formula C29H31ClN2O and a molecular weight of 459.03 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]-5-phenylmethoxyindole chloride.
| Compound Name | 1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]-5-phenylmethoxyindole chloride |
|---|---|
| PubChem CID | 53424010 |
| Molecular Formula | C29H31ClN2O |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-(2-methyl-2,3-dihydroindol-1-ium-1-ylidene)ethylidene]-5-phenylmethoxyindole chloride |
| SMILES | CC1Cc2ccccc2/[N+]1=C/C=C1N(C)c2ccc(OCc3ccccc3)cc2C1(C)C.[Cl-] |
| InChI | InChI=1S/C29H31N2O.ClH/c1-21-18-23-12-8-9-13-26(23)31(21)17-16-28-29(2,3)25-19-24(14-15-27(25)30(28)4)32-20-22-10-6-5-7-11-22;/h5-17,19,21H,18,20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XZZUWCWBEPOMAE-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|