About 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide
3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide (PubChem CID 53424358) has the molecular formula C10H16N4O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 53424358 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)c1[nH]cc(C2NC(CO)C(O)C2O)c1N |
| InChI | InChI=1S/C10H16N4O4/c11-5-3(1-13-7(5)10(12)18)6-9(17)8(16)4(2-15)14-6/h1,4,6,8-9,13-17H,2,11H2,(H2,12,18) |
| InChIKey | UUOZUUFHSJLJDX-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide (CID 53424358) is 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide is NC(=O)c1[nH]cc(C2NC(CO)C(O)C2O)c1N.
What is the InChIKey of 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide?
The InChIKey is UUOZUUFHSJLJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O4/c11-5-3(1-13-7(5)10(12)18)6-9(17)8(16)4(2-15)14-6/h1,4,6,8-9,13-17H,2,11H2,(H2,12,18).
What are the key properties of 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide?
3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide has a molecular weight of 256.26 g/mol, XLogP of -2.58, 3 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 53424358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).