About 2-pentylnon-2-en-1-ol
2-pentylnon-2-en-1-ol (PubChem CID 53424761) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-pentylnon-2-en-1-ol.
Molecular Properties
| Compound Name | 2-pentylnon-2-en-1-ol |
| PubChem CID | 53424761 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 2-pentylnon-2-en-1-ol |
| SMILES | CCCCCCC=C(CO)CCCCC |
| InChI | InChI=1S/C14H28O/c1-3-5-7-8-10-12-14(13-15)11-9-6-4-2/h12,15H,3-11,13H2,1-2H3 |
| InChIKey | UGGNQPPKUCTOQA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylnon-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylnon-2-en-1-ol?
The IUPAC name of 2-pentylnon-2-en-1-ol (CID 53424761) is 2-pentylnon-2-en-1-ol.
What is the SMILES notation for 2-pentylnon-2-en-1-ol?
The canonical SMILES for 2-pentylnon-2-en-1-ol is CCCCCCC=C(CO)CCCCC.
What is the InChIKey of 2-pentylnon-2-en-1-ol?
The InChIKey is UGGNQPPKUCTOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-3-5-7-8-10-12-14(13-15)11-9-6-4-2/h12,15H,3-11,13H2,1-2H3.
What are the key properties of 2-pentylnon-2-en-1-ol?
2-pentylnon-2-en-1-ol has a molecular weight of 212.38 g/mol, XLogP of 4.46, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylnon-2-en-1-ol is sourced from PubChem (CID 53424761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).