About 2H-quinolin-3-imine
2H-quinolin-3-imine (PubChem CID 53424822) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2H-quinolin-3-imine.
Molecular Properties
| Compound Name | 2H-quinolin-3-imine |
| PubChem CID | 53424822 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2H-quinolin-3-imine |
| SMILES | [H]/N=C1/C=c2ccccc2=NC1 |
| InChI | InChI=1S/C9H8N2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-5,10H,6H2/b10-8- |
| InChIKey | TYKBASBVACVZAS-NTMALXAHSA-N |
| XLogP | 0.12 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2H-quinolin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-quinolin-3-imine?
The IUPAC name of 2H-quinolin-3-imine (CID 53424822) is 2H-quinolin-3-imine.
What is the SMILES notation for 2H-quinolin-3-imine?
The canonical SMILES for 2H-quinolin-3-imine is [H]/N=C1/C=c2ccccc2=NC1.
What is the InChIKey of 2H-quinolin-3-imine?
The InChIKey is TYKBASBVACVZAS-NTMALXAHSA-N. The full InChI is InChI=1S/C9H8N2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-5,10H,6H2/b10-8-.
What are the key properties of 2H-quinolin-3-imine?
2H-quinolin-3-imine has a molecular weight of 144.18 g/mol, XLogP of 0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-quinolin-3-imine is sourced from PubChem (CID 53424822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).