C37H40N4O8-2 — CID 53425438
but-2-enedioate;3-[2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]benzimidazol-1-yl]-1-(3,4,5-trimethoxyphenyl)propan-1-one (PubChem CID 53425438) has the molecular formula C37H40N4O8-2 and a molecular weight of 668.75 g/mol. Its IUPAC name is but-2-enedioate;3-[2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]benzimidazol-1-yl]-1-(3,4,5-trimethoxyphenyl)propan-1-one.
| Compound Name | but-2-enedioate;3-[2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]benzimidazol-1-yl]-1-(3,4,5-trimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 53425438 |
| Molecular Formula | C37H40N4O8-2 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | but-2-enedioate;3-[2-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]benzimidazol-1-yl]-1-(3,4,5-trimethoxyphenyl)propan-1-one |
| SMILES | COc1cc(C(=O)CCn2c(CN3CCN(CC=Cc4ccccc4)CC3)nc3ccccc32)cc(OC)c1OC.O=C([O-])C=CC(=O)[O-] |
| InChI | InChI=1S/C33H38N4O4.C4H4O4/c1-39-30-22-26(23-31(40-2)33(30)41-3)29(38)15-17-37-28-14-8-7-13-27(28)34-32(37)24-36-20-18-35(19-21-36)16-9-12-25-10-5-4-6-11-25;5-3(6)1-2-4(7)8/h4-14,22-23H,15-21,24H2,1-3H3;1-2H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | FJWZENFZAUZQJQ-UHFFFAOYSA-L |
| XLogP | 2.21 |
| TPSA | 149.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|