About 3-(2,4,6-trimethylheptoxy)propylazanium acetate
3-(2,4,6-trimethylheptoxy)propylazanium acetate (PubChem CID 53425586) has the molecular formula C15H33NO3
and a molecular weight of 275.43 g/mol. Its IUPAC name is 3-(2,4,6-trimethylheptoxy)propylazanium acetate.
Molecular Properties
| Compound Name | 3-(2,4,6-trimethylheptoxy)propylazanium acetate |
| PubChem CID | 53425586 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 3-(2,4,6-trimethylheptoxy)propylazanium acetate |
| SMILES | CC(=O)[O-].CC(C)CC(C)CC(C)COCCC[NH3+] |
| InChI | InChI=1S/C13H29NO.C2H4O2/c1-11(2)8-12(3)9-13(4)10-15-7-5-6-14;1-2(3)4/h11-13H,5-10,14H2,1-4H3;1H3,(H,3,4) |
| InChIKey | SFDHJKYDQUJGDT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4,6-trimethylheptoxy)propylazanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4,6-trimethylheptoxy)propylazanium acetate?
The IUPAC name of 3-(2,4,6-trimethylheptoxy)propylazanium acetate (CID 53425586) is 3-(2,4,6-trimethylheptoxy)propylazanium acetate.
What is the SMILES notation for 3-(2,4,6-trimethylheptoxy)propylazanium acetate?
The canonical SMILES for 3-(2,4,6-trimethylheptoxy)propylazanium acetate is CC(=O)[O-].CC(C)CC(C)CC(C)COCCC[NH3+].
What is the InChIKey of 3-(2,4,6-trimethylheptoxy)propylazanium acetate?
The InChIKey is SFDHJKYDQUJGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO.C2H4O2/c1-11(2)8-12(3)9-13(4)10-15-7-5-6-14;1-2(3)4/h11-13H,5-10,14H2,1-4H3;1H3,(H,3,4).
What are the key properties of 3-(2,4,6-trimethylheptoxy)propylazanium acetate?
3-(2,4,6-trimethylheptoxy)propylazanium acetate has a molecular weight of 275.43 g/mol, XLogP of 1.10, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4,6-trimethylheptoxy)propylazanium acetate is sourced from PubChem (CID 53425586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).