About 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine
4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine (PubChem CID 53425931) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine.
Molecular Properties
| Compound Name | 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine |
| PubChem CID | 53425931 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine |
| SMILES | C(C=CCN1CCOCC1)=CCN1CCOCC1 |
| InChI | InChI=1S/C14H24N2O2/c1(3-5-15-7-11-17-12-8-15)2-4-6-16-9-13-18-14-10-16/h1-4H,5-14H2 |
| InChIKey | YWTMUEXSRPGWIK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine?
The IUPAC name of 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine (CID 53425931) is 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine.
What is the SMILES notation for 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine?
The canonical SMILES for 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine is C(C=CCN1CCOCC1)=CCN1CCOCC1.
What is the InChIKey of 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine?
The InChIKey is YWTMUEXSRPGWIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1(3-5-15-7-11-17-12-8-15)2-4-6-16-9-13-18-14-10-16/h1-4H,5-14H2.
What are the key properties of 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine?
4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine has a molecular weight of 252.36 g/mol, XLogP of 0.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-morpholin-4-ylhexa-2,4-dienyl)morpholine is sourced from PubChem (CID 53425931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).