C18H20O2 — CID 53425980
4,4-dimethyl-2,6-diphenyl-1,3-dioxane (PubChem CID 53425980) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-diphenyl-1,3-dioxane.
| Compound Name | 4,4-dimethyl-2,6-diphenyl-1,3-dioxane |
|---|---|
| PubChem CID | 53425980 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4,4-dimethyl-2,6-diphenyl-1,3-dioxane |
| SMILES | CC1(C)CC(c2ccccc2)OC(c2ccccc2)O1 |
| InChI | InChI=1S/C18H20O2/c1-18(2)13-16(14-9-5-3-6-10-14)19-17(20-18)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3 |
| InChIKey | YWZRCNNFDDESHR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |