C13H7Cl6N3 — CID 53426031
2-(2-phenylethenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 53426031) has the molecular formula C13H7Cl6N3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 2-(2-phenylethenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(2-phenylethenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 53426031 |
| Molecular Formula | C13H7Cl6N3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 414.88 |
| IUPAC Name | 2-(2-phenylethenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(C=Cc2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C13H7Cl6N3/c14-12(15,16)10-20-9(21-11(22-10)13(17,18)19)7-6-8-4-2-1-3-5-8/h1-7H |
| InChIKey | DQMOHZLFVGYNAN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|