About 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one
4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (PubChem CID 53426405) has the molecular formula C6H5F6NO3
and a molecular weight of 253.10 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| PubChem CID | 53426405 |
| Molecular Formula | C6H5F6NO3 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| SMILES | O=C1OC(C(F)(F)F)(C(F)(F)F)NC1CO |
| InChI | InChI=1S/C6H5F6NO3/c7-5(8,9)4(6(10,11)12)13-2(1-14)3(15)16-4/h2,13-14H,1H2 |
| InChIKey | YYCUTKOFFBAITO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The IUPAC name of 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (CID 53426405) is 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
What is the SMILES notation for 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The canonical SMILES for 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is O=C1OC(C(F)(F)F)(C(F)(F)F)NC1CO.
What is the InChIKey of 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The InChIKey is YYCUTKOFFBAITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F6NO3/c7-5(8,9)4(6(10,11)12)13-2(1-14)3(15)16-4/h2,13-14H,1H2.
What are the key properties of 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one has a molecular weight of 253.10 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is sourced from PubChem (CID 53426405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).