About 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine
4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 53426409) has the molecular formula C7H13N5
and a molecular weight of 167.22 g/mol. Its IUPAC name is 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
Analyze 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine?
The IUPAC name of 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (CID 53426409) is 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
What is the SMILES notation for 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine?
The canonical SMILES for 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine is CNc1ncnc(NC(C)C)n1.
What is the InChIKey of 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine?
The InChIKey is VKAVFXSRILAEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5/c1-5(2)11-7-10-4-9-6(8-3)12-7/h4-5H,1-3H3,(H2,8,9,10,11,12).
What are the key properties of 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine?
4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine has a molecular weight of 167.22 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine is sourced from PubChem (CID 53426409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).