C26H40O2 — CID 53426464
2-(2-phenylethyl)-4-[2-(4-propylcyclohexyl)ethyl]cyclohexane-1-carboxylic acid (PubChem CID 53426464) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 2-(2-phenylethyl)-4-[2-(4-propylcyclohexyl)ethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-(2-phenylethyl)-4-[2-(4-propylcyclohexyl)ethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 53426464 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-(2-phenylethyl)-4-[2-(4-propylcyclohexyl)ethyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(CCC2CCC(C(=O)O)C(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C26H40O2/c1-2-6-20-9-11-22(12-10-20)13-14-23-16-18-25(26(27)28)24(19-23)17-15-21-7-4-3-5-8-21/h3-5,7-8,20,22-25H,2,6,9-19H2,1H3,(H,27,28) |
| InChIKey | DWLKBOPMFWQYDI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |