About 4-bromocyclohexa-2,4-dien-1-imine
4-bromocyclohexa-2,4-dien-1-imine (PubChem CID 53426495) has the molecular formula C6H6BrN
and a molecular weight of 172.03 g/mol. Its IUPAC name is 4-bromocyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-bromocyclohexa-2,4-dien-1-imine |
| PubChem CID | 53426495 |
| Molecular Formula | C6H6BrN |
| Molecular Weight | 172.03 g/mol |
| Exact Mass | 170.97 |
| IUPAC Name | 4-bromocyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(Br)=CC1 |
| InChI | InChI=1S/C6H6BrN/c7-5-1-3-6(8)4-2-5/h1-3,8H,4H2/b8-6- |
| InChIKey | RCGWCPKPJRKBOI-VURMDHGXSA-N |
| XLogP | 2.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.03 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromocyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromocyclohexa-2,4-dien-1-imine?
The IUPAC name of 4-bromocyclohexa-2,4-dien-1-imine (CID 53426495) is 4-bromocyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 4-bromocyclohexa-2,4-dien-1-imine?
The canonical SMILES for 4-bromocyclohexa-2,4-dien-1-imine is [H]/N=C1/C=CC(Br)=CC1.
What is the InChIKey of 4-bromocyclohexa-2,4-dien-1-imine?
The InChIKey is RCGWCPKPJRKBOI-VURMDHGXSA-N. The full InChI is InChI=1S/C6H6BrN/c7-5-1-3-6(8)4-2-5/h1-3,8H,4H2/b8-6-.
What are the key properties of 4-bromocyclohexa-2,4-dien-1-imine?
4-bromocyclohexa-2,4-dien-1-imine has a molecular weight of 172.03 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromocyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 53426495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).