C14H18BNO2 — CID 53426670
4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 53426670) has the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. Its IUPAC name is 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 53426670 |
| Molecular Formula | C14H18BNO2 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | Cc1ccc(C#N)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H18BNO2/c1-10-6-7-11(9-16)12(8-10)15-17-13(2,3)14(4,5)18-15/h6-8H,1-5H3 |
| InChIKey | WJDTUXBXJIUSRQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|