C13H16N4O2 — CID 5342674
(E)-1-(2,4-dimethoxyphenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 5342674) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5342674 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | COc1ccc(/C=N/n2c(C)nnc2C)c(OC)c1 |
| InChI | InChI=1S/C13H16N4O2/c1-9-15-16-10(2)17(9)14-8-11-5-6-12(18-3)7-13(11)19-4/h5-8H,1-4H3/b14-8+ |
| InChIKey | IDHKQGBROGTAMJ-RIYZIHGNSA-N |
| XLogP | 1.79 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|