About 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol
2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 53427193) has the molecular formula C11H14FNO3
and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| PubChem CID | 53427193 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OCC1NC(c2ccc(F)cc2)C(O)C1O |
| InChI | InChI=1S/C11H14FNO3/c12-7-3-1-6(2-4-7)9-11(16)10(15)8(5-14)13-9/h1-4,8-11,13-16H,5H2 |
| InChIKey | FZVTZGQSANIFFP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol?
The IUPAC name of 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol (CID 53427193) is 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol?
The canonical SMILES for 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol is OCC1NC(c2ccc(F)cc2)C(O)C1O.
What is the InChIKey of 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol?
The InChIKey is FZVTZGQSANIFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO3/c12-7-3-1-6(2-4-7)9-11(16)10(15)8(5-14)13-9/h1-4,8-11,13-16H,5H2.
What are the key properties of 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol?
2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol has a molecular weight of 227.23 g/mol, XLogP of -0.45, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 53427193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).