About 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile
2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile (PubChem CID 53427321) has the molecular formula C8H7N5O
and a molecular weight of 189.18 g/mol. Its IUPAC name is 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile |
| PubChem CID | 53427321 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile |
| SMILES | N#CCC1Nc2ncncc2NC1=O |
| InChI | InChI=1S/C8H7N5O/c9-2-1-5-8(14)13-6-3-10-4-11-7(6)12-5/h3-5H,1H2,(H,13,14)(H,10,11,12) |
| InChIKey | VHANMCKTQRQLFA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile?
The IUPAC name of 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile (CID 53427321) is 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile.
What is the SMILES notation for 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile?
The canonical SMILES for 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile is N#CCC1Nc2ncncc2NC1=O.
What is the InChIKey of 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile?
The InChIKey is VHANMCKTQRQLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O/c9-2-1-5-8(14)13-6-3-10-4-11-7(6)12-5/h3-5H,1H2,(H,13,14)(H,10,11,12).
What are the key properties of 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile?
2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile has a molecular weight of 189.18 g/mol, XLogP of 0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxo-7,8-dihydro-5H-pteridin-7-yl)acetonitrile is sourced from PubChem (CID 53427321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).