C9H8Cl2N6 — CID 53427680
6-(5-amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 53427680) has the molecular formula C9H8Cl2N6 and a molecular weight of 271.11 g/mol. Its IUPAC name is 6-(5-amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(5-amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 53427680 |
| Molecular Formula | C9H8Cl2N6 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 6-(5-amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1cc(Cl)c(Cl)c(-c2nnc(N)nc2N)c1 |
| InChI | InChI=1S/C9H8Cl2N6/c10-5-2-3(12)1-4(6(5)11)7-8(13)15-9(14)17-16-7/h1-2H,12H2,(H4,13,14,15,17) |
| InChIKey | KSPOPUNATHRTBI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|