About 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole
1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole (PubChem CID 53427919) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole |
| PubChem CID | 53427919 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole |
| SMILES | C1=NCCN1C1OCc2ccccc21 |
| InChI | InChI=1S/C11H12N2O/c1-2-4-10-9(3-1)7-14-11(10)13-6-5-12-8-13/h1-4,8,11H,5-7H2 |
| InChIKey | SIUAAMTYZOTQQP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole?
The IUPAC name of 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole (CID 53427919) is 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole.
What is the SMILES notation for 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole?
The canonical SMILES for 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole is C1=NCCN1C1OCc2ccccc21.
What is the InChIKey of 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole?
The InChIKey is SIUAAMTYZOTQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-4-10-9(3-1)7-14-11(10)13-6-5-12-8-13/h1-4,8,11H,5-7H2.
What are the key properties of 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole?
1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole has a molecular weight of 188.23 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydro-2-benzofuran-1-yl)-4,5-dihydroimidazole is sourced from PubChem (CID 53427919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).