About 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide
3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide (PubChem CID 53427983) has the molecular formula C10H22BrNO
and a molecular weight of 252.20 g/mol. Its IUPAC name is 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide.
Molecular Properties
| Compound Name | 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide |
| PubChem CID | 53427983 |
| Molecular Formula | C10H22BrNO |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide |
| SMILES | CC1CCC(C)[N+]1(C)CCCO.[Br-] |
| InChI | InChI=1S/C10H22NO.BrH/c1-9-5-6-10(2)11(9,3)7-4-8-12;/h9-10,12H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XMNACLDJLGHPSI-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide?
The IUPAC name of 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide (CID 53427983) is 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide.
What is the SMILES notation for 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide?
The canonical SMILES for 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide is CC1CCC(C)[N+]1(C)CCCO.[Br-].
What is the InChIKey of 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide?
The InChIKey is XMNACLDJLGHPSI-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22NO.BrH/c1-9-5-6-10(2)11(9,3)7-4-8-12;/h9-10,12H,4-8H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide?
3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide has a molecular weight of 252.20 g/mol, XLogP of -1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)propan-1-ol bromide is sourced from PubChem (CID 53427983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).