About 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid
1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid (PubChem CID 53428348) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid |
| PubChem CID | 53428348 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid |
| SMILES | CCc1c(C(=O)O)c(C(=O)O)n(CC)c1C |
| InChI | InChI=1S/C11H15NO4/c1-4-7-6(3)12(5-2)9(11(15)16)8(7)10(13)14/h4-5H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | SIFGLZWVRJTNHI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid?
The IUPAC name of 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid (CID 53428348) is 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid.
What is the SMILES notation for 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid?
The canonical SMILES for 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid is CCc1c(C(=O)O)c(C(=O)O)n(CC)c1C.
What is the InChIKey of 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid?
The InChIKey is SIFGLZWVRJTNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-4-7-6(3)12(5-2)9(11(15)16)8(7)10(13)14/h4-5H2,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid?
1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid has a molecular weight of 225.24 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-5-methylpyrrole-2,3-dicarboxylic acid is sourced from PubChem (CID 53428348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).