About 2,3-dimethyltetradecane
2,3-dimethyltetradecane (PubChem CID 53428962) has the molecular formula C16H34
and a molecular weight of 226.45 g/mol. Its IUPAC name is 2,3-dimethyltetradecane.
Molecular Properties
| Compound Name | 2,3-dimethyltetradecane |
| PubChem CID | 53428962 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 2,3-dimethyltetradecane |
| SMILES | CCCCCCCCCCCC(C)C(C)C |
| InChI | InChI=1S/C16H34/c1-5-6-7-8-9-10-11-12-13-14-16(4)15(2)3/h15-16H,5-14H2,1-4H3 |
| InChIKey | ZQRVEWIJXCRTFW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyltetradecane?
The IUPAC name of 2,3-dimethyltetradecane (CID 53428962) is 2,3-dimethyltetradecane.
What is the SMILES notation for 2,3-dimethyltetradecane?
The canonical SMILES for 2,3-dimethyltetradecane is CCCCCCCCCCCC(C)C(C)C.
What is the InChIKey of 2,3-dimethyltetradecane?
The InChIKey is ZQRVEWIJXCRTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34/c1-5-6-7-8-9-10-11-12-13-14-16(4)15(2)3/h15-16H,5-14H2,1-4H3.
What are the key properties of 2,3-dimethyltetradecane?
2,3-dimethyltetradecane has a molecular weight of 226.45 g/mol, XLogP of 6.20, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyltetradecane is sourced from PubChem (CID 53428962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).