C23H23ClN4O4 — CID 5342899
(4Z)-1-(3-chloro-4-methylphenyl)-4-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylidene]pyrazolidine-3,5-dione (PubChem CID 5342899) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is (4Z)-1-(3-chloro-4-methylphenyl)-4-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4Z)-1-(3-chloro-4-methylphenyl)-4-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 5342899 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (4Z)-1-(3-chloro-4-methylphenyl)-4-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylidene]pyrazolidine-3,5-dione |
| SMILES | Cc1ccc(N2NC(=O)/C(=C/c3ccc(N4CCC(C)CC4)c([N+](=O)[O-])c3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O4/c1-14-7-9-26(10-8-14)20-6-4-16(12-21(20)28(31)32)11-18-22(29)25-27(23(18)30)17-5-3-15(2)19(24)13-17/h3-6,11-14H,7-10H2,1-2H3,(H,25,29)/b18-11- |
| InChIKey | IEJUZSVZVPQRNT-WQRHYEAKSA-N |
| XLogP | 4.25 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|