C7H7NO4S — CID 53429616
6-methylsulfonylpyridine-3-carboxylic acid (PubChem CID 53429616) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is 6-methylsulfonylpyridine-3-carboxylic acid.
| Compound Name | 6-methylsulfonylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53429616 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 6-methylsulfonylpyridine-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C7H7NO4S/c1-13(11,12)6-3-2-5(4-8-6)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey | VXELRDIIZXYOMH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |