About (2-acetyl-4-bromophenyl) ethyl carbonate
(2-acetyl-4-bromophenyl) ethyl carbonate (PubChem CID 53429860) has the molecular formula C11H11BrO4
and a molecular weight of 287.11 g/mol. Its IUPAC name is (2-acetyl-4-bromophenyl) ethyl carbonate.
Molecular Properties
| Compound Name | (2-acetyl-4-bromophenyl) ethyl carbonate |
| PubChem CID | 53429860 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | (2-acetyl-4-bromophenyl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(Br)cc1C(C)=O |
| InChI | InChI=1S/C11H11BrO4/c1-3-15-11(14)16-10-5-4-8(12)6-9(10)7(2)13/h4-6H,3H2,1-2H3 |
| InChIKey | SUWZOOYWFQQTCB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyl-4-bromophenyl) ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyl-4-bromophenyl) ethyl carbonate?
The IUPAC name of (2-acetyl-4-bromophenyl) ethyl carbonate (CID 53429860) is (2-acetyl-4-bromophenyl) ethyl carbonate.
What is the SMILES notation for (2-acetyl-4-bromophenyl) ethyl carbonate?
The canonical SMILES for (2-acetyl-4-bromophenyl) ethyl carbonate is CCOC(=O)Oc1ccc(Br)cc1C(C)=O.
What is the InChIKey of (2-acetyl-4-bromophenyl) ethyl carbonate?
The InChIKey is SUWZOOYWFQQTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO4/c1-3-15-11(14)16-10-5-4-8(12)6-9(10)7(2)13/h4-6H,3H2,1-2H3.
What are the key properties of (2-acetyl-4-bromophenyl) ethyl carbonate?
(2-acetyl-4-bromophenyl) ethyl carbonate has a molecular weight of 287.11 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyl-4-bromophenyl) ethyl carbonate is sourced from PubChem (CID 53429860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).