About 2-ethyl-4,4,4-trifluorobut-2-enoate
2-ethyl-4,4,4-trifluorobut-2-enoate (PubChem CID 53430222) has the molecular formula C6H6F3O2-
and a molecular weight of 167.11 g/mol. Its IUPAC name is 2-ethyl-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | 2-ethyl-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 53430222 |
| Molecular Formula | C6H6F3O2- |
| Molecular Weight | 167.11 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 2-ethyl-4,4,4-trifluorobut-2-enoate |
| SMILES | CCC(=CC(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C6H7F3O2/c1-2-4(5(10)11)3-6(7,8)9/h3H,2H2,1H3,(H,10,11)/p-1 |
| InChIKey | YUCGDISABATVHK-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.11 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,4,4-trifluorobut-2-enoate?
The IUPAC name of 2-ethyl-4,4,4-trifluorobut-2-enoate (CID 53430222) is 2-ethyl-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for 2-ethyl-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for 2-ethyl-4,4,4-trifluorobut-2-enoate is CCC(=CC(F)(F)F)C(=O)[O-].
What is the InChIKey of 2-ethyl-4,4,4-trifluorobut-2-enoate?
The InChIKey is YUCGDISABATVHK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7F3O2/c1-2-4(5(10)11)3-6(7,8)9/h3H,2H2,1H3,(H,10,11)/p-1.
What are the key properties of 2-ethyl-4,4,4-trifluorobut-2-enoate?
2-ethyl-4,4,4-trifluorobut-2-enoate has a molecular weight of 167.11 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 53430222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).