C36H39N4P — CID 53430914
dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane (PubChem CID 53430914) has the molecular formula C36H39N4P and a molecular weight of 558.71 g/mol. Its IUPAC name is dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane.
| Compound Name | dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane |
|---|---|
| PubChem CID | 53430914 |
| Molecular Formula | C36H39N4P |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane |
| SMILES | c1ccc(-c2nn(-c3ccccc3)c(-c3ccccc3)c2-n2nccc2P(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C36H39N4P/c1-6-16-28(17-7-1)34-36(35(29-18-8-2-9-19-29)39(38-34)30-20-10-3-11-21-30)40-33(26-27-37-40)41(31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-3,6-11,16-21,26-27,31-32H,4-5,12-15,22-25H2 |
| InChIKey | ZMENEJKATASVIH-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|