C20H14 — CID 53431217
pentacyclo[10.7.1.02,7.02,11.016,20]icosa-1(19),4,6,8,10,12,14,16(20),17-nonaene (PubChem CID 53431217) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is pentacyclo[10.7.1.02,7.02,11.016,20]icosa-1(19),4,6,8,10,12,14,16(20),17-nonaene.
| Compound Name | pentacyclo[10.7.1.02,7.02,11.016,20]icosa-1(19),4,6,8,10,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 53431217 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | pentacyclo[10.7.1.02,7.02,11.016,20]icosa-1(19),4,6,8,10,12,14,16(20),17-nonaene |
| SMILES | C1=CCC23C(=C1)C=CC=C2c1cccc2cccc3c12 |
| InChI | InChI=1S/C20H14/c1-2-13-20-15(8-1)9-5-11-17(20)16-10-3-6-14-7-4-12-18(20)19(14)16/h1-12H,13H2 |
| InChIKey | MABHEJQYIXIBRP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |