C14H14Cl2N4O2 — CID 5343138
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)propanamide (PubChem CID 5343138) has the molecular formula C14H14Cl2N4O2 and a molecular weight of 341.20 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)propanamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 5343138 |
| Molecular Formula | C14H14Cl2N4O2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)propanamide |
| SMILES | CC1=NNC(=O)C1CCC(=O)N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O2/c1-8-9(14(22)20-18-8)5-6-13(21)19-17-7-10-11(15)3-2-4-12(10)16/h2-4,7,9H,5-6H2,1H3,(H,19,21)(H,20,22)/b17-7+ |
| InChIKey | GVDIXRLFARVMNE-REZTVBANSA-N |
| XLogP | 2.35 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|