C48H28N4O8S — CID 53431510
2-N,5-N-bis(5-benzamido-9,10-dioxoanthracen-1-yl)thiophene-2,5-dicarboxamide (PubChem CID 53431510) has the molecular formula C48H28N4O8S and a molecular weight of 820.84 g/mol. Its IUPAC name is 2-N,5-N-bis(5-benzamido-9,10-dioxoanthracen-1-yl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(5-benzamido-9,10-dioxoanthracen-1-yl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 53431510 |
| Molecular Formula | C48H28N4O8S |
| Molecular Weight | 820.84 g/mol |
| Exact Mass | 820.16 |
| IUPAC Name | 2-N,5-N-bis(5-benzamido-9,10-dioxoanthracen-1-yl)thiophene-2,5-dicarboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccc(C(=O)Nc4cccc5c4C(=O)c4cccc(NC(=O)c6ccccc6)c4C5=O)s3)c1C2=O)c1ccccc1 |
| InChI | InChI=1S/C48H28N4O8S/c53-41-29-17-9-21-33(39(29)43(55)27-15-7-19-31(37(27)41)49-45(57)25-11-3-1-4-12-25)51-47(59)35-23-24-36(61-35)48(60)52-34-22-10-18-30-40(34)44(56)28-16-8-20-32(38(28)42(30)54)50-46(58)26-13-5-2-6-14-26/h1-24H,(H,49,57)(H,50,58)(H,51,59)(H,52,60) |
| InChIKey | RNDNNQUALPYABR-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.84 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|