About N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide
N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide (PubChem CID 53432038) has the molecular formula C9H18N2O4
and a molecular weight of 218.25 g/mol. Its IUPAC name is N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide |
| PubChem CID | 53432038 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide |
| SMILES | CC(=O)NCC1NC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C9H18N2O4/c1-4-7(13)9(15)8(14)6(11-4)3-10-5(2)12/h4,6-9,11,13-15H,3H2,1-2H3,(H,10,12) |
| InChIKey | PCXCXTZASITUBF-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide?
The IUPAC name of N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide (CID 53432038) is N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide.
What is the SMILES notation for N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide?
The canonical SMILES for N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide is CC(=O)NCC1NC(C)C(O)C(O)C1O.
What is the InChIKey of N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide?
The InChIKey is PCXCXTZASITUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4/c1-4-7(13)9(15)8(14)6(11-4)3-10-5(2)12/h4,6-9,11,13-15H,3H2,1-2H3,(H,10,12).
What are the key properties of N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide?
N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide has a molecular weight of 218.25 g/mol, XLogP of -2.43, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4,5-trihydroxy-6-methylpiperidin-2-yl)methyl]acetamide is sourced from PubChem (CID 53432038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).