C28H23NO3S2 — CID 5343238
(5Z)-5-[[2-(4-ethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5343238) has the molecular formula C28H23NO3S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-ethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(4-ethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5343238 |
| Molecular Formula | C28H23NO3S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (5Z)-5-[[2-(4-ethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(C2=C(/C=C3\SC(=S)NC3=O)C(c3ccccc3C)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C28H23NO3S2/c1-3-31-19-14-12-18(13-15-19)26-22(16-24-27(30)29-28(33)34-24)25(20-9-5-4-8-17(20)2)21-10-6-7-11-23(21)32-26/h4-16,25H,3H2,1-2H3,(H,29,30,33)/b24-16- |
| InChIKey | ZIHVWNFQRPSWJN-JLPGSUDCSA-N |
| XLogP | 6.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|