About tert-butyl 4-bromo-2,6-difluorobenzoate
tert-butyl 4-bromo-2,6-difluorobenzoate (PubChem CID 53432588) has the molecular formula C11H11BrF2O2
and a molecular weight of 293.11 g/mol. Its IUPAC name is tert-butyl 4-bromo-2,6-difluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-bromo-2,6-difluorobenzoate |
| PubChem CID | 53432588 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | tert-butyl 4-bromo-2,6-difluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-11(2,3)16-10(15)9-7(13)4-6(12)5-8(9)14/h4-5H,1-3H3 |
| InChIKey | KKTKGKORENKLNV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 4-bromo-2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-bromo-2,6-difluorobenzoate?
The IUPAC name of tert-butyl 4-bromo-2,6-difluorobenzoate (CID 53432588) is tert-butyl 4-bromo-2,6-difluorobenzoate.
What is the SMILES notation for tert-butyl 4-bromo-2,6-difluorobenzoate?
The canonical SMILES for tert-butyl 4-bromo-2,6-difluorobenzoate is CC(C)(C)OC(=O)c1c(F)cc(Br)cc1F.
What is the InChIKey of tert-butyl 4-bromo-2,6-difluorobenzoate?
The InChIKey is KKTKGKORENKLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2O2/c1-11(2,3)16-10(15)9-7(13)4-6(12)5-8(9)14/h4-5H,1-3H3.
What are the key properties of tert-butyl 4-bromo-2,6-difluorobenzoate?
tert-butyl 4-bromo-2,6-difluorobenzoate has a molecular weight of 293.11 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-bromo-2,6-difluorobenzoate is sourced from PubChem (CID 53432588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).