C17H22N3O2- — CID 53432664
2-tert-butyl-4-[cyano(phenyl)methyl]piperazine-1-carboxylate (PubChem CID 53432664) has the molecular formula C17H22N3O2- and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-tert-butyl-4-[cyano(phenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 2-tert-butyl-4-[cyano(phenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 53432664 |
| Molecular Formula | C17H22N3O2- |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-tert-butyl-4-[cyano(phenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)C1CN(C(C#N)c2ccccc2)CCN1C(=O)[O-] |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)15-12-19(9-10-20(15)16(21)22)14(11-18)13-7-5-4-6-8-13/h4-8,14-15H,9-10,12H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | DSIWRZJKFPGRCV-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |