C20H13Cl2N3O2S — CID 53432877
N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)formamide (PubChem CID 53432877) has the molecular formula C20H13Cl2N3O2S and a molecular weight of 430.32 g/mol. Its IUPAC name is N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)formamide.
| Compound Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)formamide |
|---|---|
| PubChem CID | 53432877 |
| Molecular Formula | C20H13Cl2N3O2S |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenyl-1,3-thiazol-2-yl)formamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1N(C=O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H13Cl2N3O2S/c1-12-19(18(24-27-12)17-14(21)8-5-9-15(17)22)25(11-26)20-23-16(10-28-20)13-6-3-2-4-7-13/h2-11H,1H3 |
| InChIKey | GQSWKMHGQBZGTI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|