About 2H-anthracene-1,9,10-trione
2H-anthracene-1,9,10-trione (PubChem CID 53433123) has the molecular formula C14H8O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2H-anthracene-1,9,10-trione.
Molecular Properties
| Compound Name | 2H-anthracene-1,9,10-trione |
| PubChem CID | 53433123 |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2H-anthracene-1,9,10-trione |
| SMILES | O=C1CC=CC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-6H,7H2 |
| InChIKey | AIWWFEBAHIXODC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2H-anthracene-1,9,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-anthracene-1,9,10-trione?
The IUPAC name of 2H-anthracene-1,9,10-trione (CID 53433123) is 2H-anthracene-1,9,10-trione.
What is the SMILES notation for 2H-anthracene-1,9,10-trione?
The canonical SMILES for 2H-anthracene-1,9,10-trione is O=C1CC=CC2=C1C(=O)c1ccccc1C2=O.
What is the InChIKey of 2H-anthracene-1,9,10-trione?
The InChIKey is AIWWFEBAHIXODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-6H,7H2.
What are the key properties of 2H-anthracene-1,9,10-trione?
2H-anthracene-1,9,10-trione has a molecular weight of 224.22 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-anthracene-1,9,10-trione is sourced from PubChem (CID 53433123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).