C22H29N5S — CID 53433270
3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-4-cyclohexyl-1H-1,2,4-triazole-5-thione (PubChem CID 53433270) has the molecular formula C22H29N5S and a molecular weight of 395.58 g/mol. Its IUPAC name is 3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-4-cyclohexyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-4-cyclohexyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 53433270 |
| Molecular Formula | C22H29N5S |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]-4-cyclohexyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2nc(C(C)(C)C)cc2-c2n[nH]c(=S)n2C2CCCCC2)c1 |
| InChI | InChI=1S/C22H29N5S/c1-15-9-8-12-17(13-15)27-18(14-19(25-27)22(2,3)4)20-23-24-21(28)26(20)16-10-6-5-7-11-16/h8-9,12-14,16H,5-7,10-11H2,1-4H3,(H,24,28) |
| InChIKey | PNKWIGTZMYIIQW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|