About 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride
1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride (PubChem CID 53433546) has the molecular formula C10H18Cl2N2O
and a molecular weight of 253.17 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride |
| PubChem CID | 53433546 |
| Molecular Formula | C10H18Cl2N2O |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride |
| SMILES | CNCc1ncc(C)c(OC)c1C.Cl.Cl |
| InChI | InChI=1S/C10H16N2O.2ClH/c1-7-5-12-9(6-11-3)8(2)10(7)13-4;;/h5,11H,6H2,1-4H3;2*1H |
| InChIKey | FRGURPFPURLDNK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride?
The IUPAC name of 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride (CID 53433546) is 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride.
What is the SMILES notation for 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride?
The canonical SMILES for 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride is CNCc1ncc(C)c(OC)c1C.Cl.Cl.
What is the InChIKey of 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride?
The InChIKey is FRGURPFPURLDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O.2ClH/c1-7-5-12-9(6-11-3)8(2)10(7)13-4;;/h5,11H,6H2,1-4H3;2*1H.
What are the key properties of 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride?
1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride has a molecular weight of 253.17 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methylmethanamine;dihydrochloride is sourced from PubChem (CID 53433546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).