About (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride
(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (PubChem CID 53433568) has the molecular formula C7H8ClN3OS
and a molecular weight of 217.68 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| PubChem CID | 53433568 |
| Molecular Formula | C7H8ClN3OS |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| SMILES | Cl.NCc1noc(-c2cccs2)n1 |
| InChI | InChI=1S/C7H7N3OS.ClH/c8-4-6-9-7(11-10-6)5-2-1-3-12-5;/h1-3H,4,8H2;1H |
| InChIKey | HKPQRWYPKHSLGK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The IUPAC name of (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (CID 53433568) is (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The canonical SMILES for (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride is Cl.NCc1noc(-c2cccs2)n1.
What is the InChIKey of (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The InChIKey is HKPQRWYPKHSLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS.ClH/c8-4-6-9-7(11-10-6)5-2-1-3-12-5;/h1-3H,4,8H2;1H.
What are the key properties of (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride has a molecular weight of 217.68 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 53433568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).