About 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (PubChem CID 53433643) has the molecular formula C7H12ClN3O
and a molecular weight of 189.65 g/mol. Its IUPAC name is 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 53433643 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C7H11N3O.ClH/c8-4-3-6-9-7(10-11-6)5-1-2-5;/h5H,1-4,8H2;1H |
| InChIKey | XHKLKJBMAKRYHM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CID 53433643) is 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is Cl.NCCc1nc(C2CC2)no1.
What is the InChIKey of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
The InChIKey is XHKLKJBMAKRYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.ClH/c8-4-3-6-9-7(10-11-6)5-1-2-5;/h5H,1-4,8H2;1H.
What are the key properties of 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride?
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride has a molecular weight of 189.65 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 53433643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).