C18H19N5S — CID 5343383
4-[(E)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline (PubChem CID 5343383) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[(E)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 5343383 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(E)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/n2cnnc2SCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N5S/c1-22(2)17-10-8-15(9-11-17)12-20-23-14-19-21-18(23)24-13-16-6-4-3-5-7-16/h3-12,14H,13H2,1-2H3/b20-12+ |
| InChIKey | ACCIHRIPMVFQGT-UDWIEESQSA-N |
| XLogP | 3.52 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|