C44H28F2O2 — CID 53433869
[2-(4-fluorobenzoyl)-3,4,5,6-tetraphenylphenyl]-(4-fluorophenyl)methanone (PubChem CID 53433869) has the molecular formula C44H28F2O2 and a molecular weight of 626.70 g/mol. Its IUPAC name is [2-(4-fluorobenzoyl)-3,4,5,6-tetraphenylphenyl]-(4-fluorophenyl)methanone.
| Compound Name | [2-(4-fluorobenzoyl)-3,4,5,6-tetraphenylphenyl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 53433869 |
| Molecular Formula | C44H28F2O2 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [2-(4-fluorobenzoyl)-3,4,5,6-tetraphenylphenyl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1c(C(=O)c2ccc(F)cc2)c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C44H28F2O2/c45-35-25-21-33(22-26-35)43(47)41-39(31-17-9-3-10-18-31)37(29-13-5-1-6-14-29)38(30-15-7-2-8-16-30)40(32-19-11-4-12-20-32)42(41)44(48)34-23-27-36(46)28-24-34/h1-28H |
| InChIKey | HKINRCRKYJOMPF-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |