About 1-(3-chloropropyl)-2,3,4-trifluorobenzene
1-(3-chloropropyl)-2,3,4-trifluorobenzene (PubChem CID 53433999) has the molecular formula C9H8ClF3
and a molecular weight of 208.61 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,3,4-trifluorobenzene.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-2,3,4-trifluorobenzene |
| PubChem CID | 53433999 |
| Molecular Formula | C9H8ClF3 |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-(3-chloropropyl)-2,3,4-trifluorobenzene |
| SMILES | Fc1ccc(CCCCl)c(F)c1F |
| InChI | InChI=1S/C9H8ClF3/c10-5-1-2-6-3-4-7(11)9(13)8(6)12/h3-4H,1-2,5H2 |
| InChIKey | YBZIRMFOTPUYDH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-2,3,4-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-2,3,4-trifluorobenzene?
The IUPAC name of 1-(3-chloropropyl)-2,3,4-trifluorobenzene (CID 53433999) is 1-(3-chloropropyl)-2,3,4-trifluorobenzene.
What is the SMILES notation for 1-(3-chloropropyl)-2,3,4-trifluorobenzene?
The canonical SMILES for 1-(3-chloropropyl)-2,3,4-trifluorobenzene is Fc1ccc(CCCCl)c(F)c1F.
What is the InChIKey of 1-(3-chloropropyl)-2,3,4-trifluorobenzene?
The InChIKey is YBZIRMFOTPUYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3/c10-5-1-2-6-3-4-7(11)9(13)8(6)12/h3-4H,1-2,5H2.
What are the key properties of 1-(3-chloropropyl)-2,3,4-trifluorobenzene?
1-(3-chloropropyl)-2,3,4-trifluorobenzene has a molecular weight of 208.61 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-2,3,4-trifluorobenzene is sourced from PubChem (CID 53433999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).