About 6-chloro-3-methyl-1,6-dihydropyridazine
6-chloro-3-methyl-1,6-dihydropyridazine (PubChem CID 53434684) has the molecular formula C5H7ClN2
and a molecular weight of 130.58 g/mol. Its IUPAC name is 6-chloro-3-methyl-1,6-dihydropyridazine.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-1,6-dihydropyridazine |
| PubChem CID | 53434684 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 6-chloro-3-methyl-1,6-dihydropyridazine |
| SMILES | CC1=NNC(Cl)C=C1 |
| InChI | InChI=1S/C5H7ClN2/c1-4-2-3-5(6)8-7-4/h2-3,5,8H,1H3 |
| InChIKey | MUYQAHYVJBHJOC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-methyl-1,6-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-1,6-dihydropyridazine?
The IUPAC name of 6-chloro-3-methyl-1,6-dihydropyridazine (CID 53434684) is 6-chloro-3-methyl-1,6-dihydropyridazine.
What is the SMILES notation for 6-chloro-3-methyl-1,6-dihydropyridazine?
The canonical SMILES for 6-chloro-3-methyl-1,6-dihydropyridazine is CC1=NNC(Cl)C=C1.
What is the InChIKey of 6-chloro-3-methyl-1,6-dihydropyridazine?
The InChIKey is MUYQAHYVJBHJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2/c1-4-2-3-5(6)8-7-4/h2-3,5,8H,1H3.
What are the key properties of 6-chloro-3-methyl-1,6-dihydropyridazine?
6-chloro-3-methyl-1,6-dihydropyridazine has a molecular weight of 130.58 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-1,6-dihydropyridazine is sourced from PubChem (CID 53434684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).