About 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride (PubChem CID 53434891) has the molecular formula C7H9Cl2NO
and a molecular weight of 194.06 g/mol. Its IUPAC name is 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride |
| PubChem CID | 53434891 |
| Molecular Formula | C7H9Cl2NO |
| Molecular Weight | 194.06 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride |
| SMILES | Cc1c(Cl)cc[n+]([O-])c1C.Cl |
| InChI | InChI=1S/C7H8ClNO.ClH/c1-5-6(2)9(10)4-3-7(5)8;/h3-4H,1-2H3;1H |
| InChIKey | ASIGIXCYAWOIHV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride?
The IUPAC name of 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride (CID 53434891) is 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride.
What is the SMILES notation for 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride?
The canonical SMILES for 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride is Cc1c(Cl)cc[n+]([O-])c1C.Cl.
What is the InChIKey of 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride?
The InChIKey is ASIGIXCYAWOIHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO.ClH/c1-5-6(2)9(10)4-3-7(5)8;/h3-4H,1-2H3;1H.
What are the key properties of 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride?
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride has a molecular weight of 194.06 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium;hydrochloride is sourced from PubChem (CID 53434891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).