About 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride
6,7-diaminoquinoxaline-2,3-dione;dihydrochloride (PubChem CID 53435400) has the molecular formula C8H8Cl2N4O2
and a molecular weight of 263.08 g/mol. Its IUPAC name is 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride.
Molecular Properties
| Compound Name | 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride |
| PubChem CID | 53435400 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc2c(cc1N)=NC(=O)C(=O)N=2 |
| InChI | InChI=1S/C8H6N4O2.2ClH/c9-3-1-5-6(2-4(3)10)12-8(14)7(13)11-5;;/h1-2H,9-10H2;2*1H |
| InChIKey | WPYRAKVNPXHFKQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride?
The IUPAC name of 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride (CID 53435400) is 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride.
What is the SMILES notation for 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride?
The canonical SMILES for 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride is Cl.Cl.Nc1cc2c(cc1N)=NC(=O)C(=O)N=2.
What is the InChIKey of 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride?
The InChIKey is WPYRAKVNPXHFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2.2ClH/c9-3-1-5-6(2-4(3)10)12-8(14)7(13)11-5;;/h1-2H,9-10H2;2*1H.
What are the key properties of 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride?
6,7-diaminoquinoxaline-2,3-dione;dihydrochloride has a molecular weight of 263.08 g/mol, XLogP of -1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diaminoquinoxaline-2,3-dione;dihydrochloride is sourced from PubChem (CID 53435400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).